C22H28BNO4 — CID 162725056
benzyl N-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate (PubChem CID 162725056) has the molecular formula C22H28BNO4 and a molecular weight of 381.28 g/mol. Its IUPAC name is benzyl N-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate.
| Compound Name | benzyl N-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 162725056 |
| Molecular Formula | C22H28BNO4 |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | benzyl N-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H28BNO4/c1-16-13-19(23-27-21(2,3)22(4,5)28-23)12-11-18(16)14-24-20(25)26-15-17-9-7-6-8-10-17/h6-13H,14-15H2,1-5H3,(H,24,25) |
| InChIKey | CSNGZNQYCWZUQC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|