C25H27BO4 — CID 58195019
benzyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]acetate (PubChem CID 58195019) has the molecular formula C25H27BO4 and a molecular weight of 402.30 g/mol. Its IUPAC name is benzyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]acetate.
| Compound Name | benzyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 58195019 |
| Molecular Formula | C25H27BO4 |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | benzyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]acetate |
| SMILES | CC1(C)OB(c2ccc3cc(CC(=O)OCc4ccccc4)ccc3c2)OC1(C)C |
| InChI | InChI=1S/C25H27BO4/c1-24(2)25(3,4)30-26(29-24)22-13-12-20-14-19(10-11-21(20)16-22)15-23(27)28-17-18-8-6-5-7-9-18/h5-14,16H,15,17H2,1-4H3 |
| InChIKey | NGGAIIAPTAYQQH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|