C17H20BNO4 — CID 91484895
[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl] carbamate (PubChem CID 91484895) has the molecular formula C17H20BNO4 and a molecular weight of 313.16 g/mol. Its IUPAC name is [6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl] carbamate.
| Compound Name | [6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl] carbamate |
|---|---|
| PubChem CID | 91484895 |
| Molecular Formula | C17H20BNO4 |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl] carbamate |
| SMILES | CC1(C)OB(c2ccc3cc(OC(N)=O)ccc3c2)OC1(C)C |
| InChI | InChI=1S/C17H20BNO4/c1-16(2)17(3,4)23-18(22-16)13-7-5-12-10-14(21-15(19)20)8-6-11(12)9-13/h5-10H,1-4H3,(H2,19,20) |
| InChIKey | HALBMQRDOCQUCR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|