C14H17BN2O5 — CID 174995749
[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-yl] carbamate (PubChem CID 174995749) has the molecular formula C14H17BN2O5 and a molecular weight of 304.11 g/mol. Its IUPAC name is [6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-yl] carbamate.
| Compound Name | [6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-yl] carbamate |
|---|---|
| PubChem CID | 174995749 |
| Molecular Formula | C14H17BN2O5 |
| Molecular Weight | 304.11 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | [6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-yl] carbamate |
| SMILES | CC1(C)OB(c2ccc3c(OC(N)=O)noc3c2)OC1(C)C |
| InChI | InChI=1S/C14H17BN2O5/c1-13(2)14(3,4)22-15(21-13)8-5-6-9-10(7-8)20-17-11(9)19-12(16)18/h5-7H,1-4H3,(H2,16,18) |
| InChIKey | NUAJXXJQGZXYJG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.11 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|