C12H18BN3O4 — CID 175284855
[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazin-3-yl] carbamate (PubChem CID 175284855) has the molecular formula C12H18BN3O4 and a molecular weight of 279.11 g/mol. Its IUPAC name is [4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazin-3-yl] carbamate.
| Compound Name | [4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazin-3-yl] carbamate |
|---|---|
| PubChem CID | 175284855 |
| Molecular Formula | C12H18BN3O4 |
| Molecular Weight | 279.11 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | [4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazin-3-yl] carbamate |
| SMILES | Cc1c(B2OC(C)(C)C(C)(C)O2)cnnc1OC(N)=O |
| InChI | InChI=1S/C12H18BN3O4/c1-7-8(6-15-16-9(7)18-10(14)17)13-19-11(2,3)12(4,5)20-13/h6H,1-5H3,(H2,14,17) |
| InChIKey | VYCBFTCMIJMDRS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 96.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.11 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|