C10H15BN2O4S — CID 175058223
[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl] carbamate (PubChem CID 175058223) has the molecular formula C10H15BN2O4S and a molecular weight of 270.12 g/mol. Its IUPAC name is [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl] carbamate.
| Compound Name | [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl] carbamate |
|---|---|
| PubChem CID | 175058223 |
| Molecular Formula | C10H15BN2O4S |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl] carbamate |
| SMILES | CC1(C)OB(c2cnc(OC(N)=O)s2)OC1(C)C |
| InChI | InChI=1S/C10H15BN2O4S/c1-9(2)10(3,4)17-11(16-9)6-5-13-8(18-6)15-7(12)14/h5H,1-4H3,(H2,12,14) |
| InChIKey | YDEPQTVDOSFQMI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|