C18H34BNO2SSi — CID 46318055
tri(propan-2-yl)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]silane (PubChem CID 46318055) has the molecular formula C18H34BNO2SSi and a molecular weight of 367.44 g/mol. Its IUPAC name is tri(propan-2-yl)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]silane.
| Compound Name | tri(propan-2-yl)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]silane |
|---|---|
| PubChem CID | 46318055 |
| Molecular Formula | C18H34BNO2SSi |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | tri(propan-2-yl)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]silane |
| SMILES | CC(C)[Si](c1ncc(B2OC(C)(C)C(C)(C)O2)s1)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H34BNO2SSi/c1-12(2)24(13(3)4,14(5)6)16-20-11-15(23-16)19-21-17(7,8)18(9,10)22-19/h11-14H,1-10H3 |
| InChIKey | ZNEZXNSVTBKUIP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|