C14H21BN2O3S — CID 131439506
1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]piperidin-4-one (PubChem CID 131439506) has the molecular formula C14H21BN2O3S and a molecular weight of 308.21 g/mol. Its IUPAC name is 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]piperidin-4-one.
| Compound Name | 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]piperidin-4-one |
|---|---|
| PubChem CID | 131439506 |
| Molecular Formula | C14H21BN2O3S |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]piperidin-4-one |
| SMILES | CC1(C)OB(c2cnc(N3CCC(=O)CC3)s2)OC1(C)C |
| InChI | InChI=1S/C14H21BN2O3S/c1-13(2)14(3,4)20-15(19-13)11-9-16-12(21-11)17-7-5-10(18)6-8-17/h9H,5-8H2,1-4H3 |
| InChIKey | MFYGJBHQNCIXOM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|