C17H22BF2NO3 — CID 178164366
1-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-one (PubChem CID 178164366) has the molecular formula C17H22BF2NO3 and a molecular weight of 337.18 g/mol. Its IUPAC name is 1-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-one.
| Compound Name | 1-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-one |
|---|---|
| PubChem CID | 178164366 |
| Molecular Formula | C17H22BF2NO3 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-one |
| SMILES | CC1(C)OB(c2ccc(N3CCC(=O)CC3)c(F)c2F)OC1(C)C |
| InChI | InChI=1S/C17H22BF2NO3/c1-16(2)17(3,4)24-18(23-16)12-5-6-13(15(20)14(12)19)21-9-7-11(22)8-10-21/h5-6H,7-10H2,1-4H3 |
| InChIKey | KSOWKIVCLIMKOK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|