C17H22BFN2O4 — CID 164719806
1-(2-fluoro-4-nitrophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine (PubChem CID 164719806) has the molecular formula C17H22BFN2O4 and a molecular weight of 348.18 g/mol. Its IUPAC name is 1-(2-fluoro-4-nitrophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(2-fluoro-4-nitrophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 164719806 |
| Molecular Formula | C17H22BFN2O4 |
| Molecular Weight | 348.18 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 1-(2-fluoro-4-nitrophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CC1(C)OB(C2=CCN(c3ccc([N+](=O)[O-])cc3F)CC2)OC1(C)C |
| InChI | InChI=1S/C17H22BFN2O4/c1-16(2)17(3,4)25-18(24-16)12-7-9-20(10-8-12)15-6-5-13(21(22)23)11-14(15)19/h5-7,11H,8-10H2,1-4H3 |
| InChIKey | YKUJBVBHMDYOGI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.18 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|