C17H17F3N2O2 — CID 164970091
4-(6,6-difluorocyclohexen-1-yl)-1-(2-fluoro-4-nitrophenyl)-3,6-dihydro-2H-pyridine (PubChem CID 164970091) has the molecular formula C17H17F3N2O2 and a molecular weight of 338.33 g/mol. Its IUPAC name is 4-(6,6-difluorocyclohexen-1-yl)-1-(2-fluoro-4-nitrophenyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 4-(6,6-difluorocyclohexen-1-yl)-1-(2-fluoro-4-nitrophenyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 164970091 |
| Molecular Formula | C17H17F3N2O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 4-(6,6-difluorocyclohexen-1-yl)-1-(2-fluoro-4-nitrophenyl)-3,6-dihydro-2H-pyridine |
| SMILES | O=[N+]([O-])c1ccc(N2CC=C(C3=CCCCC3(F)F)CC2)c(F)c1 |
| InChI | InChI=1S/C17H17F3N2O2/c18-15-11-13(22(23)24)4-5-16(15)21-9-6-12(7-10-21)14-3-1-2-8-17(14,19)20/h3-6,11H,1-2,7-10H2 |
| InChIKey | QMZKVIASXOTSOP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|