C23H35B2NO4 — CID 58449644
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,6-dihydro-2H-pyridine (PubChem CID 58449644) has the molecular formula C23H35B2NO4 and a molecular weight of 411.16 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 58449644 |
| Molecular Formula | C23H35B2NO4 |
| Molecular Weight | 411.16 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,6-dihydro-2H-pyridine |
| SMILES | CC1(C)OB(C2=CCN(c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)CC2)OC1(C)C |
| InChI | InChI=1S/C23H35B2NO4/c1-20(2)21(3,4)28-24(27-20)17-9-11-19(12-10-17)26-15-13-18(14-16-26)25-29-22(5,6)23(7,8)30-25/h9-13H,14-16H2,1-8H3 |
| InChIKey | RVONEGOPQCNRNY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.16 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|