C30H46BBrN4O2 — CID 160638542
1-(4-bromophenyl)-4-ethylpiperazine;1-ethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine (PubChem CID 160638542) has the molecular formula C30H46BBrN4O2 and a molecular weight of 585.44 g/mol. Its IUPAC name is 1-(4-bromophenyl)-4-ethylpiperazine;1-ethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine.
| Compound Name | 1-(4-bromophenyl)-4-ethylpiperazine;1-ethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine |
|---|---|
| PubChem CID | 160638542 |
| Molecular Formula | C30H46BBrN4O2 |
| Molecular Weight | 585.44 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | 1-(4-bromophenyl)-4-ethylpiperazine;1-ethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine |
| SMILES | CCN1CCN(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)CC1.CCN1CCN(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C18H29BN2O2.C12H17BrN2/c1-6-20-11-13-21(14-12-20)16-9-7-15(8-10-16)19-22-17(2,3)18(4,5)23-19;1-2-14-7-9-15(10-8-14)12-5-3-11(13)4-6-12/h7-10H,6,11-14H2,1-5H3;3-6H,2,7-10H2,1H3 |
| InChIKey | RIWBTKWKJKJAGI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 31.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|