C22H37BN2O4 — CID 140882045
1-(2,2-diethoxyethyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine (PubChem CID 140882045) has the molecular formula C22H37BN2O4 and a molecular weight of 404.36 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine.
| Compound Name | 1-(2,2-diethoxyethyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine |
|---|---|
| PubChem CID | 140882045 |
| Molecular Formula | C22H37BN2O4 |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine |
| SMILES | CCOC(CN1CCN(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)CC1)OCC |
| InChI | InChI=1S/C22H37BN2O4/c1-7-26-20(27-8-2)17-24-13-15-25(16-14-24)19-11-9-18(10-12-19)23-28-21(3,4)22(5,6)29-23/h9-12,20H,7-8,13-17H2,1-6H3 |
| InChIKey | ORJHVYZWVBOGEV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|