C19H28BF3N2O2 — CID 175475051
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(2,3,3-trifluoropropyl)piperazine (PubChem CID 175475051) has the molecular formula C19H28BF3N2O2 and a molecular weight of 384.25 g/mol. Its IUPAC name is 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(2,3,3-trifluoropropyl)piperazine.
| Compound Name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(2,3,3-trifluoropropyl)piperazine |
|---|---|
| PubChem CID | 175475051 |
| Molecular Formula | C19H28BF3N2O2 |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(2,3,3-trifluoropropyl)piperazine |
| SMILES | CC1(C)OB(c2ccc(N3CCN(CC(F)C(F)F)CC3)cc2)OC1(C)C |
| InChI | InChI=1S/C19H28BF3N2O2/c1-18(2)19(3,4)27-20(26-18)14-5-7-15(8-6-14)25-11-9-24(10-12-25)13-16(21)17(22)23/h5-8,16-17H,9-13H2,1-4H3 |
| InChIKey | SADDEPFCGKMSMQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|