C16H22BNO2 — CID 11346283
1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyrrole (PubChem CID 11346283) has the molecular formula C16H22BNO2 and a molecular weight of 271.17 g/mol. Its IUPAC name is 1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyrrole.
| Compound Name | 1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 11346283 |
| Molecular Formula | C16H22BNO2 |
| Molecular Weight | 271.17 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyrrole |
| SMILES | CC1(C)OB(C2=CCN(c3ccccc3)C2)OC1(C)C |
| InChI | InChI=1S/C16H22BNO2/c1-15(2)16(3,4)20-17(19-15)13-10-11-18(12-13)14-8-6-5-7-9-14/h5-10H,11-12H2,1-4H3 |
| InChIKey | PRLOIHYDZVKGFS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.17 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|