C19H32BNO2 — CID 142617717
ethane;1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine (PubChem CID 142617717) has the molecular formula C19H32BNO2 and a molecular weight of 317.28 g/mol. Its IUPAC name is ethane;1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine.
| Compound Name | ethane;1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine |
|---|---|
| PubChem CID | 142617717 |
| Molecular Formula | C19H32BNO2 |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | ethane;1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine |
| SMILES | CC.CC1(C)OB(c2cccc(N3CCCCC3)c2)OC1(C)C |
| InChI | InChI=1S/C17H26BNO2.C2H6/c1-16(2)17(3,4)21-18(20-16)14-9-8-10-15(13-14)19-11-6-5-7-12-19;1-2/h8-10,13H,5-7,11-12H2,1-4H3;1-2H3 |
| InChIKey | INFQJSABVSZFFF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|