C26H32BBrF4N2O2 — CID 158435309
1-(3-bromophenyl)-3,3-difluoropyrrolidine;3,3-difluoro-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine (PubChem CID 158435309) has the molecular formula C26H32BBrF4N2O2 and a molecular weight of 571.26 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3,3-difluoropyrrolidine;3,3-difluoro-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine.
| Compound Name | 1-(3-bromophenyl)-3,3-difluoropyrrolidine;3,3-difluoro-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 158435309 |
| Molecular Formula | C26H32BBrF4N2O2 |
| Molecular Weight | 571.26 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | 1-(3-bromophenyl)-3,3-difluoropyrrolidine;3,3-difluoro-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine |
| SMILES | CC1(C)OB(c2cccc(N3CCC(F)(F)C3)c2)OC1(C)C.FC1(F)CCN(c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C16H22BF2NO2.C10H10BrF2N/c1-14(2)15(3,4)22-17(21-14)12-6-5-7-13(10-12)20-9-8-16(18,19)11-20;11-8-2-1-3-9(6-8)14-5-4-10(12,13)7-14/h5-7,10H,8-9,11H2,1-4H3;1-3,6H,4-5,7H2 |
| InChIKey | HCDPQUQZQZUZCA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.26 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|