C16H22BF2NO2S — CID 147373265
3,3-difluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylpyrrolidine (PubChem CID 147373265) has the molecular formula C16H22BF2NO2S and a molecular weight of 341.23 g/mol. Its IUPAC name is 3,3-difluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylpyrrolidine.
| Compound Name | 3,3-difluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylpyrrolidine |
|---|---|
| PubChem CID | 147373265 |
| Molecular Formula | C16H22BF2NO2S |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3,3-difluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylpyrrolidine |
| SMILES | CC1(C)OB(c2ccc(SN3CCC(F)(F)C3)cc2)OC1(C)C |
| InChI | InChI=1S/C16H22BF2NO2S/c1-14(2)15(3,4)22-17(21-14)12-5-7-13(8-6-12)23-20-10-9-16(18,19)11-20/h5-8H,9-11H2,1-4H3 |
| InChIKey | DJNCBYOWZIOVTP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|