C18H26BF2NO2 — CID 169422678
3,3-difluoro-1-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine (PubChem CID 169422678) has the molecular formula C18H26BF2NO2 and a molecular weight of 337.22 g/mol. Its IUPAC name is 3,3-difluoro-1-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine.
| Compound Name | 3,3-difluoro-1-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine |
|---|---|
| PubChem CID | 169422678 |
| Molecular Formula | C18H26BF2NO2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 3,3-difluoro-1-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine |
| SMILES | Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1CN1CCC(F)(F)C1 |
| InChI | InChI=1S/C18H26BF2NO2/c1-13-6-7-15(19-23-16(2,3)17(4,5)24-19)10-14(13)11-22-9-8-18(20,21)12-22/h6-7,10H,8-9,11-12H2,1-5H3 |
| InChIKey | MCWJHARFCNAIRB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|