C34H50BBrN4O6 — CID 161119255
N-[1-(3-bromophenyl)piperidin-4-yl]-2-methoxyacetamide;2-methoxy-N-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]acetamide (PubChem CID 161119255) has the molecular formula C34H50BBrN4O6 and a molecular weight of 701.51 g/mol. Its IUPAC name is N-[1-(3-bromophenyl)piperidin-4-yl]-2-methoxyacetamide;2-methoxy-N-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]acetamide.
| Compound Name | N-[1-(3-bromophenyl)piperidin-4-yl]-2-methoxyacetamide;2-methoxy-N-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 161119255 |
| Molecular Formula | C34H50BBrN4O6 |
| Molecular Weight | 701.51 g/mol |
| Exact Mass | 700.30 |
| IUPAC Name | N-[1-(3-bromophenyl)piperidin-4-yl]-2-methoxyacetamide;2-methoxy-N-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]acetamide |
| SMILES | COCC(=O)NC1CCN(c2cccc(B3OC(C)(C)C(C)(C)O3)c2)CC1.COCC(=O)NC1CCN(c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C20H31BN2O4.C14H19BrN2O2/c1-19(2)20(3,4)27-21(26-19)15-7-6-8-17(13-15)23-11-9-16(10-12-23)22-18(24)14-25-5;1-19-10-14(18)16-12-5-7-17(8-6-12)13-4-2-3-11(15)9-13/h6-8,13,16H,9-12,14H2,1-5H3,(H,22,24);2-4,9,12H,5-8,10H2,1H3,(H,16,18) |
| InChIKey | UKSQLCLZLDBESO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|