C13H16BrNO — CID 117025219
1-(3-bromophenyl)-4,4-dimethylpiperidin-3-one (PubChem CID 117025219) has the molecular formula C13H16BrNO and a molecular weight of 282.18 g/mol. Its IUPAC name is 1-(3-bromophenyl)-4,4-dimethylpiperidin-3-one.
| Compound Name | 1-(3-bromophenyl)-4,4-dimethylpiperidin-3-one |
|---|---|
| PubChem CID | 117025219 |
| Molecular Formula | C13H16BrNO |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 1-(3-bromophenyl)-4,4-dimethylpiperidin-3-one |
| SMILES | CC1(C)CCN(c2cccc(Br)c2)CC1=O |
| InChI | InChI=1S/C13H16BrNO/c1-13(2)6-7-15(9-12(13)16)11-5-3-4-10(14)8-11/h3-5,8H,6-7,9H2,1-2H3 |
| InChIKey | RCDBTBVKXWGEPZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |