C21H23BF2N2O3 — CID 178092772
4-fluoro-N-(2-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxamide (PubChem CID 178092772) has the molecular formula C21H23BF2N2O3 and a molecular weight of 400.23 g/mol. Its IUPAC name is 4-fluoro-N-(2-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxamide.
| Compound Name | 4-fluoro-N-(2-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 178092772 |
| Molecular Formula | C21H23BF2N2O3 |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 4-fluoro-N-(2-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxamide |
| SMILES | CC1(C)OB(c2ccc3c(c2F)CCN3C(=O)Nc2ccccc2F)OC1(C)C |
| InChI | InChI=1S/C21H23BF2N2O3/c1-20(2)21(3,4)29-22(28-20)14-9-10-17-13(18(14)24)11-12-26(17)19(27)25-16-8-6-5-7-15(16)23/h5-10H,11-12H2,1-4H3,(H,25,27) |
| InChIKey | ZNVCOVPNMHNJPH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|