C14H18BF2NO3 — CID 166086414
N-[2,6-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (PubChem CID 166086414) has the molecular formula C14H18BF2NO3 and a molecular weight of 297.11 g/mol. Its IUPAC name is N-[2,6-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide.
| Compound Name | N-[2,6-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 166086414 |
| Molecular Formula | C14H18BF2NO3 |
| Molecular Weight | 297.11 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N-[2,6-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1c(F)ccc(B2OC(C)(C)C(C)(C)O2)c1F |
| InChI | InChI=1S/C14H18BF2NO3/c1-8(19)18-12-10(16)7-6-9(11(12)17)15-20-13(2,3)14(4,5)21-15/h6-7H,1-5H3,(H,18,19) |
| InChIKey | NYAYNKKZWKBCME-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.11 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|