C27H28BF2NO4 — CID 176561369
2,6-difluoro-N-[4-(phenylmethoxymethyl)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 176561369) has the molecular formula C27H28BF2NO4 and a molecular weight of 479.33 g/mol. Its IUPAC name is 2,6-difluoro-N-[4-(phenylmethoxymethyl)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | 2,6-difluoro-N-[4-(phenylmethoxymethyl)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 176561369 |
| Molecular Formula | C27H28BF2NO4 |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 2,6-difluoro-N-[4-(phenylmethoxymethyl)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CC1(C)OB(c2ccc(F)c(C(=O)Nc3ccc(COCc4ccccc4)cc3)c2F)OC1(C)C |
| InChI | InChI=1S/C27H28BF2NO4/c1-26(2)27(3,4)35-28(34-26)21-14-15-22(29)23(24(21)30)25(32)31-20-12-10-19(11-13-20)17-33-16-18-8-6-5-7-9-18/h5-15H,16-17H2,1-4H3,(H,31,32) |
| InChIKey | ROQRYIZXOCSTMM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|