C24H26BNO4 — CID 118991831
benzyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]carbamate (PubChem CID 118991831) has the molecular formula C24H26BNO4 and a molecular weight of 403.29 g/mol. Its IUPAC name is benzyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]carbamate.
| Compound Name | benzyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 118991831 |
| Molecular Formula | C24H26BNO4 |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | benzyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]carbamate |
| SMILES | CC1(C)OB(c2ccc(NC(=O)OCc3ccccc3)c3ccccc23)OC1(C)C |
| InChI | InChI=1S/C24H26BNO4/c1-23(2)24(3,4)30-25(29-23)20-14-15-21(19-13-9-8-12-18(19)20)26-22(27)28-16-17-10-6-5-7-11-17/h5-15H,16H2,1-4H3,(H,26,27) |
| InChIKey | VSWVMONVJYCRRF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|