C18H22BN3O4 — CID 170991882
benzyl 4-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxylate (PubChem CID 170991882) has the molecular formula C18H22BN3O4 and a molecular weight of 355.20 g/mol. Its IUPAC name is benzyl 4-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxylate.
| Compound Name | benzyl 4-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 170991882 |
| Molecular Formula | C18H22BN3O4 |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | benzyl 4-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxylate |
| SMILES | CC1(C)OB(c2cnc(C(=O)OCc3ccccc3)nc2N)OC1(C)C |
| InChI | InChI=1S/C18H22BN3O4/c1-17(2)18(3,4)26-19(25-17)13-10-21-15(22-14(13)20)16(23)24-11-12-8-6-5-7-9-12/h5-10H,11H2,1-4H3,(H2,20,21,22) |
| InChIKey | UFCYEZVLINFHHN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 96.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|