C23H29BO5 — CID 175894722
2-[2-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl acetate (PubChem CID 175894722) has the molecular formula C23H29BO5 and a molecular weight of 396.29 g/mol. Its IUPAC name is 2-[2-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl acetate.
| Compound Name | 2-[2-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl acetate |
|---|---|
| PubChem CID | 175894722 |
| Molecular Formula | C23H29BO5 |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 2-[2-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl acetate |
| SMILES | CC(=O)OCCc1cccc(B2OC(C)(C)C(C)(C)O2)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H29BO5/c1-17(25)26-15-14-19-12-9-13-20(24-28-22(2,3)23(4,5)29-24)21(19)27-16-18-10-7-6-8-11-18/h6-13H,14-16H2,1-5H3 |
| InChIKey | FKXMHXPNNXARLE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|