C24H32BNO4 — CID 169109649
benzyl N-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]carbamate (PubChem CID 169109649) has the molecular formula C24H32BNO4 and a molecular weight of 409.34 g/mol. Its IUPAC name is benzyl N-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]carbamate.
| Compound Name | benzyl N-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 169109649 |
| Molecular Formula | C24H32BNO4 |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | benzyl N-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]carbamate |
| SMILES | CC1(C)OB(c2ccc(CCCCNC(=O)OCc3ccccc3)cc2)OC1(C)C |
| InChI | InChI=1S/C24H32BNO4/c1-23(2)24(3,4)30-25(29-23)21-15-13-19(14-16-21)10-8-9-17-26-22(27)28-18-20-11-6-5-7-12-20/h5-7,11-16H,8-10,17-18H2,1-4H3,(H,26,27) |
| InChIKey | JUISVXHMNSDHNE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|