C21H34BNO4 — CID 177141204
ethyl N-[6-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hexyl]carbamate (PubChem CID 177141204) has the molecular formula C21H34BNO4 and a molecular weight of 375.32 g/mol. Its IUPAC name is ethyl N-[6-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hexyl]carbamate.
| Compound Name | ethyl N-[6-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hexyl]carbamate |
|---|---|
| PubChem CID | 177141204 |
| Molecular Formula | C21H34BNO4 |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | ethyl N-[6-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hexyl]carbamate |
| SMILES | CCOC(=O)NCCCCCCc1ccccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H34BNO4/c1-6-25-19(24)23-16-12-8-7-9-13-17-14-10-11-15-18(17)22-26-20(2,3)21(4,5)27-22/h10-11,14-15H,6-9,12-13,16H2,1-5H3,(H,23,24) |
| InChIKey | BRZNDMUEOXUSFK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|