C19H30BNO5 — CID 175662974
N,N-bis(2-hydroxyethyl)-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide (PubChem CID 175662974) has the molecular formula C19H30BNO5 and a molecular weight of 363.26 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 175662974 |
| Molecular Formula | C19H30BNO5 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide |
| SMILES | CC1(C)OB(c2ccccc2CCC(=O)N(CCO)CCO)OC1(C)C |
| InChI | InChI=1S/C19H30BNO5/c1-18(2)19(3,4)26-20(25-18)16-8-6-5-7-15(16)9-10-17(24)21(11-13-22)12-14-23/h5-8,22-23H,9-14H2,1-4H3 |
| InChIKey | WRKZBWYRRHAZIM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|