C36H54B2N2O8 — CID 145270599
ethyl 2-[2-[(2-ethoxy-2-oxoethyl)-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]amino]ethyl-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]amino]acetate (PubChem CID 145270599) has the molecular formula C36H54B2N2O8 and a molecular weight of 664.46 g/mol. Its IUPAC name is ethyl 2-[2-[(2-ethoxy-2-oxoethyl)-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]amino]ethyl-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]amino]acetate.
| Compound Name | ethyl 2-[2-[(2-ethoxy-2-oxoethyl)-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]amino]ethyl-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]amino]acetate |
|---|---|
| PubChem CID | 145270599 |
| Molecular Formula | C36H54B2N2O8 |
| Molecular Weight | 664.46 g/mol |
| Exact Mass | 664.41 |
| IUPAC Name | ethyl 2-[2-[(2-ethoxy-2-oxoethyl)-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]amino]ethyl-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]amino]acetate |
| SMILES | CCOC(=O)CN(CCN(CC(=O)OCC)Cc1ccccc1B1OC(C)(C)C(C)(C)O1)Cc1ccccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C36H54B2N2O8/c1-11-43-31(41)25-39(23-27-17-13-15-19-29(27)37-45-33(3,4)34(5,6)46-37)21-22-40(26-32(42)44-12-2)24-28-18-14-16-20-30(28)38-47-35(7,8)36(9,10)48-38/h13-20H,11-12,21-26H2,1-10H3 |
| InChIKey | DMMRTICBGUVKPK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|