C16H22BClO4 — CID 129010524
ethyl 2-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate (PubChem CID 129010524) has the molecular formula C16H22BClO4 and a molecular weight of 324.61 g/mol. Its IUPAC name is ethyl 2-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate.
| Compound Name | ethyl 2-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
|---|---|
| PubChem CID | 129010524 |
| Molecular Formula | C16H22BClO4 |
| Molecular Weight | 324.61 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | ethyl 2-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(B2OC(C)(C)C(C)(C)O2)c(Cl)c1 |
| InChI | InChI=1S/C16H22BClO4/c1-6-20-14(19)10-11-7-8-12(13(18)9-11)17-21-15(2,3)16(4,5)22-17/h7-9H,6,10H2,1-5H3 |
| InChIKey | FJTRXEWDGWGDQR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.61 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|