C24H25BO6 — CID 168849134
(2-oxochromen-7-yl) 3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate (PubChem CID 168849134) has the molecular formula C24H25BO6 and a molecular weight of 420.27 g/mol. Its IUPAC name is (2-oxochromen-7-yl) 3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate.
| Compound Name | (2-oxochromen-7-yl) 3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 168849134 |
| Molecular Formula | C24H25BO6 |
| Molecular Weight | 420.27 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (2-oxochromen-7-yl) 3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate |
| SMILES | CC1(C)OB(c2ccccc2CCC(=O)Oc2ccc3ccc(=O)oc3c2)OC1(C)C |
| InChI | InChI=1S/C24H25BO6/c1-23(2)24(3,4)31-25(30-23)19-8-6-5-7-16(19)10-13-21(26)28-18-12-9-17-11-14-22(27)29-20(17)15-18/h5-9,11-12,14-15H,10,13H2,1-4H3 |
| InChIKey | GLYDEPABJCNZEN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|