C27H34O4 — CID 53393978
(2-oxochromen-7-yl) octadeca-6,9,12-trienoate (PubChem CID 53393978) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is (2-oxochromen-7-yl) octadeca-6,9,12-trienoate.
| Compound Name | (2-oxochromen-7-yl) octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 53393978 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | (2-oxochromen-7-yl) octadeca-6,9,12-trienoate |
| SMILES | CCCCCC=CCC=CCC=CCCCCC(=O)Oc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C27H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-26(28)30-24-20-18-23-19-21-27(29)31-25(23)22-24/h6-7,9-10,12-13,18-22H,2-5,8,11,14-17H2,1H3 |
| InChIKey | LPIXSKJJCANUQD-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|