C28H37F3O4 — CID 87634016
(2-oxochromen-7-yl) (Z)-4-(trifluoromethyl)octadec-9-enoate (PubChem CID 87634016) has the molecular formula C28H37F3O4 and a molecular weight of 494.59 g/mol. Its IUPAC name is (2-oxochromen-7-yl) (Z)-4-(trifluoromethyl)octadec-9-enoate.
| Compound Name | (2-oxochromen-7-yl) (Z)-4-(trifluoromethyl)octadec-9-enoate |
|---|---|
| PubChem CID | 87634016 |
| Molecular Formula | C28H37F3O4 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | (2-oxochromen-7-yl) (Z)-4-(trifluoromethyl)octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCC(CCC(=O)Oc1ccc2ccc(=O)oc2c1)C(F)(F)F |
| InChI | InChI=1S/C28H37F3O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-23(28(29,30)31)17-20-26(32)34-24-18-15-22-16-19-27(33)35-25(22)21-24/h9-10,15-16,18-19,21,23H,2-8,11-14,17,20H2,1H3/b10-9- |
| InChIKey | LFMZTOUSUXUISR-KTKRTIGZSA-N |
| XLogP | 8.52 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|