C27H40O3 — CID 69424372
(3-oxo-1,2-dihydroinden-5-yl) (Z)-octadec-9-enoate (PubChem CID 69424372) has the molecular formula C27H40O3 and a molecular weight of 412.61 g/mol. Its IUPAC name is (3-oxo-1,2-dihydroinden-5-yl) (Z)-octadec-9-enoate.
| Compound Name | (3-oxo-1,2-dihydroinden-5-yl) (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 69424372 |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | (3-oxo-1,2-dihydroinden-5-yl) (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Oc1ccc2c(c1)C(=O)CC2 |
| InChI | InChI=1S/C27H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-27(29)30-24-20-18-23-19-21-26(28)25(23)22-24/h9-10,18,20,22H,2-8,11-17,19,21H2,1H3/b10-9- |
| InChIKey | YIEFQMKWJZVPIY-KTKRTIGZSA-N |
| XLogP | 7.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|