C15H19NO3 — CID 47140803
(2-oxo-3,4-dihydro-1H-quinolin-6-yl) hexanoate (PubChem CID 47140803) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl) hexanoate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) hexanoate |
|---|---|
| PubChem CID | 47140803 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) hexanoate |
| SMILES | CCCCCC(=O)Oc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C15H19NO3/c1-2-3-4-5-15(18)19-12-7-8-13-11(10-12)6-9-14(17)16-13/h7-8,10H,2-6,9H2,1H3,(H,16,17) |
| InChIKey | PSJABFARRFAUDJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|