C19H23N3O4 — CID 71896511
(2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)butanoate (PubChem CID 71896511) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)butanoate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)butanoate |
|---|---|
| PubChem CID | 71896511 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)butanoate |
| SMILES | CC(C)(C)c1noc(CCCC(=O)Oc2ccc3c(c2)CCC(=O)N3)n1 |
| InChI | InChI=1S/C19H23N3O4/c1-19(2,3)18-21-16(26-22-18)5-4-6-17(24)25-13-8-9-14-12(11-13)7-10-15(23)20-14/h8-9,11H,4-7,10H2,1-3H3,(H,20,23) |
| InChIKey | KPPXHKDBUIHMAF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|