C10H9ClN2O5S — CID 116799026
(2-oxo-3,4-dihydro-1H-quinolin-6-yl) N-chlorosulfonylcarbamate (PubChem CID 116799026) has the molecular formula C10H9ClN2O5S and a molecular weight of 304.71 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl) N-chlorosulfonylcarbamate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) N-chlorosulfonylcarbamate |
|---|---|
| PubChem CID | 116799026 |
| Molecular Formula | C10H9ClN2O5S |
| Molecular Weight | 304.71 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) N-chlorosulfonylcarbamate |
| SMILES | O=C1CCc2cc(OC(=O)NS(=O)(=O)Cl)ccc2N1 |
| InChI | InChI=1S/C10H9ClN2O5S/c11-19(16,17)13-10(15)18-7-2-3-8-6(5-7)1-4-9(14)12-8/h2-3,5H,1,4H2,(H,12,14)(H,13,15) |
| InChIKey | DIMOZMMMSDKRJM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.71 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |