C17H13F2NO5S — CID 18270386
(2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-(difluoromethylsulfonyl)benzoate (PubChem CID 18270386) has the molecular formula C17H13F2NO5S and a molecular weight of 381.36 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 18270386 |
| Molecular Formula | C17H13F2NO5S |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-(difluoromethylsulfonyl)benzoate |
| SMILES | O=C1CCc2cc(OC(=O)c3ccc(S(=O)(=O)C(F)F)cc3)ccc2N1 |
| InChI | InChI=1S/C17H13F2NO5S/c18-17(19)26(23,24)13-5-1-10(2-6-13)16(22)25-12-4-7-14-11(9-12)3-8-15(21)20-14/h1-2,4-7,9,17H,3,8H2,(H,20,21) |
| InChIKey | YBTUYUGVCMHYEH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|