C20H20N2O4 — CID 95047735
(2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-morpholin-4-ylbenzoate (PubChem CID 95047735) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-morpholin-4-ylbenzoate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 95047735 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-morpholin-4-ylbenzoate |
| SMILES | O=C1CCc2cc(OC(=O)c3ccc(N4CCOCC4)cc3)ccc2N1 |
| InChI | InChI=1S/C20H20N2O4/c23-19-8-3-15-13-17(6-7-18(15)21-19)26-20(24)14-1-4-16(5-2-14)22-9-11-25-12-10-22/h1-2,4-7,13H,3,8-12H2,(H,21,23) |
| InChIKey | XMPHJZZIHSAGHR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|