C20H20N2O5S — CID 18275651
(2-oxo-3,4-dihydro-1H-quinolin-6-yl) 3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 18275651) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 18275651 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C1CCc2cc(OC(=O)c3cccc(S(=O)(=O)N4CCCC4)c3)ccc2N1 |
| InChI | InChI=1S/C20H20N2O5S/c23-19-9-6-14-12-16(7-8-18(14)21-19)27-20(24)15-4-3-5-17(13-15)28(25,26)22-10-1-2-11-22/h3-5,7-8,12-13H,1-2,6,9-11H2,(H,21,23) |
| InChIKey | HAPXEPRAUHJWQO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|