C20H20N2O6S — CID 18266738
(2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-morpholin-4-ylsulfonylbenzoate (PubChem CID 18266738) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 18266738 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C1CCc2cc(OC(=O)c3ccc(S(=O)(=O)N4CCOCC4)cc3)ccc2N1 |
| InChI | InChI=1S/C20H20N2O6S/c23-19-8-3-15-13-16(4-7-18(15)21-19)28-20(24)14-1-5-17(6-2-14)29(25,26)22-9-11-27-12-10-22/h1-2,4-7,13H,3,8-12H2,(H,21,23) |
| InChIKey | WRRGFGGJXJNXSF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|