C17H12N2O3 — CID 18288037
(2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-cyanobenzoate (PubChem CID 18288037) has the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-cyanobenzoate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-cyanobenzoate |
|---|---|
| PubChem CID | 18288037 |
| Molecular Formula | C17H12N2O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-cyanobenzoate |
| SMILES | N#Cc1ccc(C(=O)Oc2ccc3c(c2)CCC(=O)N3)cc1 |
| InChI | InChI=1S/C17H12N2O3/c18-10-11-1-3-12(4-2-11)17(21)22-14-6-7-15-13(9-14)5-8-16(20)19-15/h1-4,6-7,9H,5,8H2,(H,19,20) |
| InChIKey | XUBCWKILTMTORZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|