C20H19N3O4 — CID 47581087
(2-oxo-3,4-dihydro-1H-quinolin-6-yl) 3-methyl-4-(2-oxoimidazolidin-1-yl)benzoate (PubChem CID 47581087) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 3-methyl-4-(2-oxoimidazolidin-1-yl)benzoate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 3-methyl-4-(2-oxoimidazolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 47581087 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 3-methyl-4-(2-oxoimidazolidin-1-yl)benzoate |
| SMILES | Cc1cc(C(=O)Oc2ccc3c(c2)CCC(=O)N3)ccc1N1CCNC1=O |
| InChI | InChI=1S/C20H19N3O4/c1-12-10-14(2-6-17(12)23-9-8-21-20(23)26)19(25)27-15-4-5-16-13(11-15)3-7-18(24)22-16/h2,4-6,10-11H,3,7-9H2,1H3,(H,21,26)(H,22,24) |
| InChIKey | RZPUIEYRCPOJSA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|