C11H14N2O2 — CID 115370632
1-(4-methoxy-2-methylphenyl)imidazolidin-2-one (PubChem CID 115370632) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 1-(4-methoxy-2-methylphenyl)imidazolidin-2-one.
| Compound Name | 1-(4-methoxy-2-methylphenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 115370632 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-(4-methoxy-2-methylphenyl)imidazolidin-2-one |
| SMILES | COc1ccc(N2CCNC2=O)c(C)c1 |
| InChI | InChI=1S/C11H14N2O2/c1-8-7-9(15-2)3-4-10(8)13-6-5-12-11(13)14/h3-4,7H,5-6H2,1-2H3,(H,12,14) |
| InChIKey | RHJHGIUIIDSHSX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |