C13H16N2O3 — CID 114252939
1-(5-methoxy-2-methylphenyl)-1,4-diazepane-2,5-dione (PubChem CID 114252939) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 1-(5-methoxy-2-methylphenyl)-1,4-diazepane-2,5-dione.
| Compound Name | 1-(5-methoxy-2-methylphenyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 114252939 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-(5-methoxy-2-methylphenyl)-1,4-diazepane-2,5-dione |
| SMILES | COc1ccc(C)c(N2CCC(=O)NCC2=O)c1 |
| InChI | InChI=1S/C13H16N2O3/c1-9-3-4-10(18-2)7-11(9)15-6-5-12(16)14-8-13(15)17/h3-4,7H,5-6,8H2,1-2H3,(H,14,16) |
| InChIKey | FUQUNDFNELQVSA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |