C12H14N2O3 — CID 64955856
1-(4-methoxyphenyl)-1,4-diazepane-2,5-dione (PubChem CID 64955856) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-1,4-diazepane-2,5-dione.
| Compound Name | 1-(4-methoxyphenyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64955856 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1-(4-methoxyphenyl)-1,4-diazepane-2,5-dione |
| SMILES | COc1ccc(N2CCC(=O)NCC2=O)cc1 |
| InChI | InChI=1S/C12H14N2O3/c1-17-10-4-2-9(3-5-10)14-7-6-11(15)13-8-12(14)16/h2-5H,6-8H2,1H3,(H,13,15) |
| InChIKey | IBZCGRKBUQBIBX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |