C18H18N2O4 — CID 585094
1,4-bis(4-methoxyphenyl)piperazine-2,5-dione (PubChem CID 585094) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 1,4-bis(4-methoxyphenyl)piperazine-2,5-dione.
| Compound Name | 1,4-bis(4-methoxyphenyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 585094 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 1,4-bis(4-methoxyphenyl)piperazine-2,5-dione |
| SMILES | COc1ccc(N2CC(=O)N(c3ccc(OC)cc3)CC2=O)cc1 |
| InChI | InChI=1S/C18H18N2O4/c1-23-15-7-3-13(4-8-15)19-11-18(22)20(12-17(19)21)14-5-9-16(24-2)10-6-14/h3-10H,11-12H2,1-2H3 |
| InChIKey | USVMSKJDIQQFCA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |